C11H9N5O3 — CID 61167729
4-oxo-4-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]but-2-enoic acid (PubChem CID 61167729) has the molecular formula C11H9N5O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-oxo-4-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]but-2-enoic acid.
| Compound Name | 4-oxo-4-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 61167729 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-oxo-4-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1cccnc1-n1cncn1 |
| InChI | InChI=1S/C11H9N5O3/c17-9(3-4-10(18)19)15-8-2-1-5-13-11(8)16-7-12-6-14-16/h1-7H,(H,15,17)(H,18,19) |
| InChIKey | PVZTZIIQGTWJPJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|