C16H14N6O2 — CID 86995384
N-(pyridin-3-ylmethyl)-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide (PubChem CID 86995384) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide.
| Compound Name | N-(pyridin-3-ylmethyl)-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 86995384 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
| SMILES | O=C(NCc1cccnc1)C(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H14N6O2/c23-15(19-9-12-2-1-7-17-8-12)16(24)21-13-3-5-14(6-4-13)22-11-18-10-20-22/h1-8,10-11H,9H2,(H,19,23)(H,21,24) |
| InChIKey | FYQWPVKVQXMJJC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|