C18H14ClN7O2 — CID 86996859
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide (PubChem CID 86996859) has the molecular formula C18H14ClN7O2 and a molecular weight of 395.81 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 86996859 |
| Molecular Formula | C18H14ClN7O2 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
| SMILES | O=C(NCc1cn2cc(Cl)ccc2n1)C(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H14ClN7O2/c19-12-1-6-16-23-14(9-25(16)8-12)7-21-17(27)18(28)24-13-2-4-15(5-3-13)26-11-20-10-22-26/h1-6,8-11H,7H2,(H,21,27)(H,24,28) |
| InChIKey | RDJZSGSDEGISGI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|