C18H17N5O3 — CID 86995676
N-[(3-methoxyphenyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide (PubChem CID 86995676) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 86995676 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-N'-[4-(1,2,4-triazol-1-yl)phenyl]oxamide |
| SMILES | COc1cccc(CNC(=O)C(=O)Nc2ccc(-n3cncn3)cc2)c1 |
| InChI | InChI=1S/C18H17N5O3/c1-26-16-4-2-3-13(9-16)10-20-17(24)18(25)22-14-5-7-15(8-6-14)23-12-19-11-21-23/h2-9,11-12H,10H2,1H3,(H,20,24)(H,22,25) |
| InChIKey | KAUITEKAEVLISY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|