C17H15N5O3 — CID 51044362
N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(pyridin-3-ylmethyl)oxamide (PubChem CID 51044362) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 51044362 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N'-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(pyridin-3-ylmethyl)oxamide |
| SMILES | Cc1nnc(-c2ccc(NC(=O)C(=O)NCc3cccnc3)cc2)o1 |
| InChI | InChI=1S/C17H15N5O3/c1-11-21-22-17(25-11)13-4-6-14(7-5-13)20-16(24)15(23)19-10-12-3-2-8-18-9-12/h2-9H,10H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | JOACJOVDVIMGEX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|