C23H27N3O2 — CID 42891913
N-[4-[1-[(1-phenylcyclopropyl)methylcarbamoylamino]ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 42891913) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[4-[1-[(1-phenylcyclopropyl)methylcarbamoylamino]ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-[(1-phenylcyclopropyl)methylcarbamoylamino]ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42891913 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[4-[1-[(1-phenylcyclopropyl)methylcarbamoylamino]ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | CC(NC(=O)NCC1(c2ccccc2)CC1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-16(17-9-11-20(12-10-17)26-21(27)18-7-8-18)25-22(28)24-15-23(13-14-23)19-5-3-2-4-6-19/h2-6,9-12,16,18H,7-8,13-15H2,1H3,(H,26,27)(H2,24,25,28) |
| InChIKey | QXCQHHGZSPNGND-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |