C19H22N4O2 — CID 94038983
N-[4-[(1S)-1-(pyridin-3-ylmethylcarbamoylamino)ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 94038983) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[4-[(1S)-1-(pyridin-3-ylmethylcarbamoylamino)ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(1S)-1-(pyridin-3-ylmethylcarbamoylamino)ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 94038983 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[4-[(1S)-1-(pyridin-3-ylmethylcarbamoylamino)ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | C[C@H](NC(=O)NCc1cccnc1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-13(22-19(25)21-12-14-3-2-10-20-11-14)15-6-8-17(9-7-15)23-18(24)16-4-5-16/h2-3,6-11,13,16H,4-5,12H2,1H3,(H,23,24)(H2,21,22,25)/t13-/m0/s1 |
| InChIKey | VSPUHIHDZVCWJW-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |