C20H31ClN2O — CID 44655127
N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ium-1-ylpropanamide chloride (PubChem CID 44655127) has the molecular formula C20H31ClN2O and a molecular weight of 350.93 g/mol. Its IUPAC name is N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ium-1-ylpropanamide chloride.
| Compound Name | N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ium-1-ylpropanamide chloride |
|---|---|
| PubChem CID | 44655127 |
| Molecular Formula | C20H31ClN2O |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ium-1-ylpropanamide chloride |
| SMILES | CC(C(=O)NCC1(c2ccccc2)CCCC1)[NH+]1CCCCC1.[Cl-] |
| InChI | InChI=1S/C20H30N2O.ClH/c1-17(22-14-8-3-9-15-22)19(23)21-16-20(12-6-7-13-20)18-10-4-2-5-11-18;/h2,4-5,10-11,17H,3,6-9,12-16H2,1H3,(H,21,23);1H |
| InChIKey | IZIMQTUXNFYKRC-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |