C20H22N2O3 — CID 100789169
1-(4-nitrophenyl)-N-[(2R)-4-phenylbutan-2-yl]cyclopropane-1-carboxamide (PubChem CID 100789169) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-[(2R)-4-phenylbutan-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-nitrophenyl)-N-[(2R)-4-phenylbutan-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 100789169 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(4-nitrophenyl)-N-[(2R)-4-phenylbutan-2-yl]cyclopropane-1-carboxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)C1(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H22N2O3/c1-15(7-8-16-5-3-2-4-6-16)21-19(23)20(13-14-20)17-9-11-18(12-10-17)22(24)25/h2-6,9-12,15H,7-8,13-14H2,1H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | PSCJQUWCOYKXGR-OAHLLOKOSA-N |
| XLogP | 3.76 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|