C23H27NO4 — CID 120541500
2-methyl-3-[4-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]phenyl]propanoic acid (PubChem CID 120541500) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-methyl-3-[4-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]phenyl]propanoic acid.
| Compound Name | 2-methyl-3-[4-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120541500 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-methyl-3-[4-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]phenyl]propanoic acid |
| SMILES | Cc1ccc(C2(C(=O)Nc3ccc(CC(C)C(=O)O)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-16-3-7-19(8-4-16)23(11-13-28-14-12-23)22(27)24-20-9-5-18(6-10-20)15-17(2)21(25)26/h3-10,17H,11-15H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | YEGCZCLPIFRPOX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |