C33H55N5O7 — CID 176995153
2-[[5-hydroxy-2-[[(6Z)-8-methyl-5-methylidenenona-6,8-dienoyl]amino]hex-5-enoyl]amino]-4-oxo-4-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]butanoic acid (PubChem CID 176995153) has the molecular formula C33H55N5O7 and a molecular weight of 633.83 g/mol. Its IUPAC name is 2-[[5-hydroxy-2-[[(6Z)-8-methyl-5-methylidenenona-6,8-dienoyl]amino]hex-5-enoyl]amino]-4-oxo-4-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]butanoic acid.
| Compound Name | 2-[[5-hydroxy-2-[[(6Z)-8-methyl-5-methylidenenona-6,8-dienoyl]amino]hex-5-enoyl]amino]-4-oxo-4-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 176995153 |
| Molecular Formula | C33H55N5O7 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.41 |
| IUPAC Name | 2-[[5-hydroxy-2-[[(6Z)-8-methyl-5-methylidenenona-6,8-dienoyl]amino]hex-5-enoyl]amino]-4-oxo-4-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]butanoic acid |
| SMILES | C=C(C)/C=C\C(=C)CCCC(=O)NC(CCC(=C)O)C(=O)NC(CC(=O)NC(CCCCNC(C)C)C(=O)NC(C)C)C(=O)O |
| InChI | InChI=1S/C33H55N5O7/c1-21(2)15-16-24(7)12-11-14-29(40)36-27(18-17-25(8)39)32(43)38-28(33(44)45)20-30(41)37-26(31(42)35-23(5)6)13-9-10-19-34-22(3)4/h15-16,22-23,26-28,34,39H,1,7-14,17-20H2,2-6H3,(H,35,42)(H,36,40)(H,37,41)(H,38,43)(H,44,45)/b16-15- |
| InChIKey | CHJAILWYEITLIR-NXVVXOECSA-N |
| XLogP | 3.32 |
| TPSA | 185.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|