C18H39N5O2 — CID 171621363
2-[3-(methylamino)propanoylamino]-6-(propan-2-ylamino)-N-[2-(propan-2-ylamino)ethyl]hexanamide (PubChem CID 171621363) has the molecular formula C18H39N5O2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 2-[3-(methylamino)propanoylamino]-6-(propan-2-ylamino)-N-[2-(propan-2-ylamino)ethyl]hexanamide.
| Compound Name | 2-[3-(methylamino)propanoylamino]-6-(propan-2-ylamino)-N-[2-(propan-2-ylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 171621363 |
| Molecular Formula | C18H39N5O2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.31 |
| IUPAC Name | 2-[3-(methylamino)propanoylamino]-6-(propan-2-ylamino)-N-[2-(propan-2-ylamino)ethyl]hexanamide |
| SMILES | CNCCC(=O)NC(CCCCNC(C)C)C(=O)NCCNC(C)C |
| InChI | InChI=1S/C18H39N5O2/c1-14(2)20-10-7-6-8-16(23-17(24)9-11-19-5)18(25)22-13-12-21-15(3)4/h14-16,19-21H,6-13H2,1-5H3,(H,22,25)(H,23,24) |
| InChIKey | DEYVKCDEXURORV-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|