C19H40N6O2 — CID 171639863
(2R)-5-(diaminomethylideneamino)-N-(5-methylhexyl)-2-[3-(propan-2-ylamino)propanoylamino]pentanamide (PubChem CID 171639863) has the molecular formula C19H40N6O2 and a molecular weight of 384.57 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-(5-methylhexyl)-2-[3-(propan-2-ylamino)propanoylamino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-(5-methylhexyl)-2-[3-(propan-2-ylamino)propanoylamino]pentanamide |
|---|---|
| PubChem CID | 171639863 |
| Molecular Formula | C19H40N6O2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-(5-methylhexyl)-2-[3-(propan-2-ylamino)propanoylamino]pentanamide |
| SMILES | CC(C)CCCCNC(=O)[C@@H](CCCN=C(N)N)NC(=O)CCNC(C)C |
| InChI | InChI=1S/C19H40N6O2/c1-14(2)8-5-6-11-23-18(27)16(9-7-12-24-19(20)21)25-17(26)10-13-22-15(3)4/h14-16,22H,5-13H2,1-4H3,(H,23,27)(H,25,26)(H4,20,21,24)/t16-/m1/s1 |
| InChIKey | PZAFJQWFSSSPSR-MRXNPFEDSA-N |
| XLogP | 0.86 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|