C33H67N5O3 — CID 165380224
8-methyl-N-[7-oxo-7-[[1-oxo-1,7-bis(propan-2-ylamino)heptan-2-yl]amino]-6-(propan-2-ylamino)heptyl]nonanamide (PubChem CID 165380224) has the molecular formula C33H67N5O3 and a molecular weight of 581.93 g/mol. Its IUPAC name is 8-methyl-N-[7-oxo-7-[[1-oxo-1,7-bis(propan-2-ylamino)heptan-2-yl]amino]-6-(propan-2-ylamino)heptyl]nonanamide.
| Compound Name | 8-methyl-N-[7-oxo-7-[[1-oxo-1,7-bis(propan-2-ylamino)heptan-2-yl]amino]-6-(propan-2-ylamino)heptyl]nonanamide |
|---|---|
| PubChem CID | 165380224 |
| Molecular Formula | C33H67N5O3 |
| Molecular Weight | 581.93 g/mol |
| Exact Mass | 581.52 |
| IUPAC Name | 8-methyl-N-[7-oxo-7-[[1-oxo-1,7-bis(propan-2-ylamino)heptan-2-yl]amino]-6-(propan-2-ylamino)heptyl]nonanamide |
| SMILES | CC(C)CCCCCCC(=O)NCCCCCC(NC(C)C)C(=O)NC(CCCCCNC(C)C)C(=O)NC(C)C |
| InChI | InChI=1S/C33H67N5O3/c1-25(2)19-13-9-10-16-22-31(39)35-24-18-12-14-20-29(36-27(5)6)33(41)38-30(32(40)37-28(7)8)21-15-11-17-23-34-26(3)4/h25-30,34,36H,9-24H2,1-8H3,(H,35,39)(H,37,40)(H,38,41) |
| InChIKey | PBXHWDPNGAQMMJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.93 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|