C21H41N3O4 — CID 171621342
ethane;6-methyl-N-[2-(methylamino)ethyl]-2-[(6-methyl-5-oxoheptanoyl)amino]-5-oxoheptanamide (PubChem CID 171621342) has the molecular formula C21H41N3O4 and a molecular weight of 399.58 g/mol. Its IUPAC name is ethane;6-methyl-N-[2-(methylamino)ethyl]-2-[(6-methyl-5-oxoheptanoyl)amino]-5-oxoheptanamide.
| Compound Name | ethane;6-methyl-N-[2-(methylamino)ethyl]-2-[(6-methyl-5-oxoheptanoyl)amino]-5-oxoheptanamide |
|---|---|
| PubChem CID | 171621342 |
| Molecular Formula | C21H41N3O4 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | ethane;6-methyl-N-[2-(methylamino)ethyl]-2-[(6-methyl-5-oxoheptanoyl)amino]-5-oxoheptanamide |
| SMILES | CC.CNCCNC(=O)C(CCC(=O)C(C)C)NC(=O)CCCC(=O)C(C)C |
| InChI | InChI=1S/C19H35N3O4.C2H6/c1-13(2)16(23)7-6-8-18(25)22-15(9-10-17(24)14(3)4)19(26)21-12-11-20-5;1-2/h13-15,20H,6-12H2,1-5H3,(H,21,26)(H,22,25);1-2H3 |
| InChIKey | HSEPDFYOHVQVRV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|