C21H31NO — CID 144925838
ethene;N-[(Z)-4-ethenylhex-4-enyl]-4-(4-methylphenyl)butanamide (PubChem CID 144925838) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is ethene;N-[(Z)-4-ethenylhex-4-enyl]-4-(4-methylphenyl)butanamide.
| Compound Name | ethene;N-[(Z)-4-ethenylhex-4-enyl]-4-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 144925838 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | ethene;N-[(Z)-4-ethenylhex-4-enyl]-4-(4-methylphenyl)butanamide |
| SMILES | C=C.C=C/C(=C\C)CCCNC(=O)CCCc1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO.C2H4/c1-4-17(5-2)9-7-15-20-19(21)10-6-8-18-13-11-16(3)12-14-18;1-2/h4-5,11-14H,1,6-10,15H2,2-3H3,(H,20,21);1-2H2/b17-5+; |
| InChIKey | XQVXTUFSZFTYPH-YAKHFBBESA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|