C20H33NO3 — CID 178048626
butanoic acid;N-butyl-5-(4-methylphenyl)pentanamide (PubChem CID 178048626) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is butanoic acid;N-butyl-5-(4-methylphenyl)pentanamide.
| Compound Name | butanoic acid;N-butyl-5-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 178048626 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | butanoic acid;N-butyl-5-(4-methylphenyl)pentanamide |
| SMILES | CCCC(=O)O.CCCCNC(=O)CCCCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H25NO.C4H8O2/c1-3-4-13-17-16(18)8-6-5-7-15-11-9-14(2)10-12-15;1-2-3-4(5)6/h9-12H,3-8,13H2,1-2H3,(H,17,18);2-3H2,1H3,(H,5,6) |
| InChIKey | ARNZBTSBAJROBC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|