C23H34N6O6 — CID 126763325
2-[(2-acetamidoacetyl)amino]-5-(methylamino)-N-[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]pentanamide (PubChem CID 126763325) has the molecular formula C23H34N6O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[(2-acetamidoacetyl)amino]-5-(methylamino)-N-[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]pentanamide.
| Compound Name | 2-[(2-acetamidoacetyl)amino]-5-(methylamino)-N-[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 126763325 |
| Molecular Formula | C23H34N6O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-[(2-acetamidoacetyl)amino]-5-(methylamino)-N-[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]pentanamide |
| SMILES | CNCCCC(NC(=O)CNC(C)=O)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NCC=O |
| InChI | InChI=1S/C23H34N6O6/c1-16(31)26-14-20(32)28-18(9-6-10-24-2)22(34)27-15-21(33)29-19(23(35)25-11-12-30)13-17-7-4-3-5-8-17/h3-5,7-8,12,18-19,24H,6,9-11,13-15H2,1-2H3,(H,25,35)(H,26,31)(H,27,34)(H,28,32)(H,29,33) |
| InChIKey | APUHUUHKQJUZNV-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|