C12H27N5O2 — CID 59688217
(2S)-2-amino-N-[(2S)-2,5-bis(methylamino)pentyl]pentanediamide (PubChem CID 59688217) has the molecular formula C12H27N5O2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-2,5-bis(methylamino)pentyl]pentanediamide.
| Compound Name | (2S)-2-amino-N-[(2S)-2,5-bis(methylamino)pentyl]pentanediamide |
|---|---|
| PubChem CID | 59688217 |
| Molecular Formula | C12H27N5O2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-2,5-bis(methylamino)pentyl]pentanediamide |
| SMILES | CNCCC[C@@H](CNC(=O)[C@@H](N)CCC(N)=O)NC |
| InChI | InChI=1S/C12H27N5O2/c1-15-7-3-4-9(16-2)8-17-12(19)10(13)5-6-11(14)18/h9-10,15-16H,3-8,13H2,1-2H3,(H2,14,18)(H,17,19)/t9-,10-/m0/s1 |
| InChIKey | MOEZDQVJZPCEFN-UWVGGRQHSA-N |
| XLogP | -1.72 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|