C11H21N3O4 — CID 91979596
tert-butyl 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]acetate (PubChem CID 91979596) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]acetate |
|---|---|
| PubChem CID | 91979596 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | tert-butyl 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C11H21N3O4/c1-11(2,3)18-9(16)6-14-10(17)7(12)4-5-8(13)15/h7H,4-6,12H2,1-3H3,(H2,13,15)(H,14,17)/t7-/m0/s1 |
| InChIKey | GDIGMJCTWRSSNO-ZETCQYMHSA-N |
| XLogP | -0.96 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |