C18H36N2O7 — CID 175504926
tert-butyl 4-amino-5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate (PubChem CID 175504926) has the molecular formula C18H36N2O7 and a molecular weight of 392.49 g/mol. Its IUPAC name is tert-butyl 4-amino-5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate.
| Compound Name | tert-butyl 4-amino-5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 175504926 |
| Molecular Formula | C18H36N2O7 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | tert-butyl 4-amino-5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate |
| SMILES | COCCOCCOCCOCCNC(=O)C(N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36N2O7/c1-18(2,3)27-16(21)6-5-15(19)17(22)20-7-8-24-11-12-26-14-13-25-10-9-23-4/h15H,5-14,19H2,1-4H3,(H,20,22) |
| InChIKey | VOLLZGCVGSIRKQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|