C15H30N2O8S — CID 148657291
(2R)-2-amino-3-[2-[2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethoxy]ethylamino]-3-oxopropane-1-sulfonic acid (PubChem CID 148657291) has the molecular formula C15H30N2O8S and a molecular weight of 398.48 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethoxy]ethylamino]-3-oxopropane-1-sulfonic acid.
| Compound Name | (2R)-2-amino-3-[2-[2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethoxy]ethylamino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 148657291 |
| Molecular Formula | C15H30N2O8S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R)-2-amino-3-[2-[2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethoxy]ethylamino]-3-oxopropane-1-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)CCCOCCOCCNC(=O)[C@@H](N)CS(=O)(=O)O |
| InChI | InChI=1S/C15H30N2O8S/c1-15(2,3)25-13(18)5-4-7-23-9-10-24-8-6-17-14(19)12(16)11-26(20,21)22/h12H,4-11,16H2,1-3H3,(H,17,19)(H,20,21,22)/t12-/m0/s1 |
| InChIKey | NNCFFNPUHIOVHA-LBPRGKRZSA-N |
| XLogP | -0.53 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|