C34H52N3O8P — CID 10974363
benzyl 2-[[(2S)-2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoyl]amino]-4-diethoxyphosphorylbutanoate (PubChem CID 10974363) has the molecular formula C34H52N3O8P and a molecular weight of 661.78 g/mol. Its IUPAC name is benzyl 2-[[(2S)-2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoyl]amino]-4-diethoxyphosphorylbutanoate.
| Compound Name | benzyl 2-[[(2S)-2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoyl]amino]-4-diethoxyphosphorylbutanoate |
|---|---|
| PubChem CID | 10974363 |
| Molecular Formula | C34H52N3O8P |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.35 |
| IUPAC Name | benzyl 2-[[(2S)-2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoyl]amino]-4-diethoxyphosphorylbutanoate |
| SMILES | CCOP(=O)(CCC(NC(=O)[C@H](C)NC(=O)CCCCNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C34H52N3O8P/c1-4-44-46(42,45-5-2)16-14-29(32(40)43-23-25-11-7-6-8-12-25)37-31(39)24(3)36-30(38)13-9-10-15-35-33(41)34-20-26-17-27(21-34)19-28(18-26)22-34/h6-8,11-12,24,26-29H,4-5,9-10,13-23H2,1-3H3,(H,35,41)(H,36,38)(H,37,39)/t24-,26?,27?,28?,29?,34?/m0/s1 |
| InChIKey | FXGRZTMAJHBBKB-ATBSGMAUSA-N |
| XLogP | 4.88 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|