C21H20ClN3O6S — CID 55941573
(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55941573) has the molecular formula C21H20ClN3O6S and a molecular weight of 477.93 g/mol. Its IUPAC name is (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55941573 |
| Molecular Formula | C21H20ClN3O6S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | Cc1oc(-c2cccs2)nc1COC(=O)[C@@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C21H20ClN3O6S/c1-11(2)18(24-19(26)13-6-7-14(22)16(9-13)25(28)29)21(27)30-10-15-12(3)31-20(23-15)17-5-4-8-32-17/h4-9,11,18H,10H2,1-3H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | GCDCUPUSLYZQLB-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|