C20H19N3O5S — CID 39951684
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 39951684) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 39951684 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | COc1ccccc1-c1nc(COC(=O)c2cc([N+](=O)[O-])ccc2N(C)C)cs1 |
| InChI | InChI=1S/C20H19N3O5S/c1-22(2)17-9-8-14(23(25)26)10-16(17)20(24)28-11-13-12-29-19(21-13)15-6-4-5-7-18(15)27-3/h4-10,12H,11H2,1-3H3 |
| InChIKey | GHYILLJMPYNWSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|