C17H13N5O2S2 — CID 9334564
2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-5-nitrobenzonitrile (PubChem CID 9334564) has the molecular formula C17H13N5O2S2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-5-nitrobenzonitrile.
| Compound Name | 2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 9334564 |
| Molecular Formula | C17H13N5O2S2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Sc1nc(N)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C17H13N5O2S2/c18-8-9-7-10(22(23)24)5-6-12(9)26-17-20-15(19)14-11-3-1-2-4-13(11)25-16(14)21-17/h5-7H,1-4H2,(H2,19,20,21) |
| InChIKey | IUNDZUZYQOHQRS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|