C23H22N6OS2 — CID 46818051
4-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 46818051) has the molecular formula C23H22N6OS2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 4-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 46818051 |
| Molecular Formula | C23H22N6OS2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 4-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CSc2nc(N)c3c4c(sc3n2)CCCC4)N(C)c2ccccc21 |
| InChI | InChI=1S/C23H22N6OS2/c1-28-15-8-4-5-9-16(15)29(2)22(28)14(11-24)17(30)12-31-23-26-20(25)19-13-7-3-6-10-18(13)32-21(19)27-23/h4-5,8-9H,3,6-7,10,12H2,1-2H3,(H2,25,26,27) |
| InChIKey | YWWNHQDRORXYPQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|