C18H18N4OS2 — CID 1130553
2-[(3-amino-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-phenylethanone (PubChem CID 1130553) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-[(3-amino-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-phenylethanone.
| Compound Name | 2-[(3-amino-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-phenylethanone |
|---|---|
| PubChem CID | 1130553 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[(3-amino-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-phenylethanone |
| SMILES | CN1CCc2c(sc3nc(SCC(=O)c4ccccc4)nc(N)c23)C1 |
| InChI | InChI=1S/C18H18N4OS2/c1-22-8-7-12-14(9-22)25-17-15(12)16(19)20-18(21-17)24-10-13(23)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H2,19,20,21) |
| InChIKey | RVSYINIQWGFZHN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |