C20H21ClN4OS2 — CID 23798928
2-[(3-amino-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-chlorophenyl)ethanone (PubChem CID 23798928) has the molecular formula C20H21ClN4OS2 and a molecular weight of 433.00 g/mol. Its IUPAC name is 2-[(3-amino-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-[(3-amino-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 23798928 |
| Molecular Formula | C20H21ClN4OS2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[(3-amino-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-chlorophenyl)ethanone |
| SMILES | CCCN1CCc2c(sc3nc(SCC(=O)c4ccc(Cl)cc4)nc(N)c23)C1 |
| InChI | InChI=1S/C20H21ClN4OS2/c1-2-8-25-9-7-14-16(10-25)28-19-17(14)18(22)23-20(24-19)27-11-15(26)12-3-5-13(21)6-4-12/h3-6H,2,7-11H2,1H3,(H2,22,23,24) |
| InChIKey | LAARSOPZTDAOQZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |