C15H22N4S2 — CID 941300
11-methyl-5-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 941300) has the molecular formula C15H22N4S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 11-methyl-5-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 11-methyl-5-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 941300 |
| Molecular Formula | C15H22N4S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 11-methyl-5-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CC(C)CCSc1nc(N)c2c3c(sc2n1)CN(C)CC3 |
| InChI | InChI=1S/C15H22N4S2/c1-9(2)5-7-20-15-17-13(16)12-10-4-6-19(3)8-11(10)21-14(12)18-15/h9H,4-8H2,1-3H3,(H2,16,17,18) |
| InChIKey | ZATNXJGUCQXYND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |