C21H26N4S2 — CID 23852215
11-benzyl-3-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-5-amine (PubChem CID 23852215) has the molecular formula C21H26N4S2 and a molecular weight of 398.60 g/mol. Its IUPAC name is 11-benzyl-3-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-5-amine.
| Compound Name | 11-benzyl-3-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-5-amine |
|---|---|
| PubChem CID | 23852215 |
| Molecular Formula | C21H26N4S2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 11-benzyl-3-(3-methylbutylsulfanyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-5-amine |
| SMILES | CC(C)CCSc1nc(N)nc2sc3c(c12)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C21H26N4S2/c1-14(2)9-11-26-19-18-16-8-10-25(12-15-6-4-3-5-7-15)13-17(16)27-20(18)24-21(22)23-19/h3-7,14H,8-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | MAJIVQMDAGTFMP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |