C18H20N4S2 — CID 171987464
12-benzyl-6-ethylsulfanyl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-4-amine (PubChem CID 171987464) has the molecular formula C18H20N4S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 12-benzyl-6-ethylsulfanyl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-4-amine.
| Compound Name | 12-benzyl-6-ethylsulfanyl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-4-amine |
|---|---|
| PubChem CID | 171987464 |
| Molecular Formula | C18H20N4S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 12-benzyl-6-ethylsulfanyl-8-thia-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-4-amine |
| SMILES | CCSc1nc(N)nc2c3c(sc12)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C18H20N4S2/c1-2-23-17-16-15(20-18(19)21-17)13-11-22(9-8-14(13)24-16)10-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H2,19,20,21) |
| InChIKey | AHGHKTTWSPIEHU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |