C13H18N4OS2 — CID 2024989
5-(2-methoxyethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 2024989) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-(2-methoxyethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 2024989 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-(2-methoxyethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | COCCSc1nc(N)c2c3c(sc2n1)CN(C)CC3 |
| InChI | InChI=1S/C13H18N4OS2/c1-17-4-3-8-9(7-17)20-12-10(8)11(14)15-13(16-12)19-6-5-18-2/h3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | KWQMKCIISOJSQV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|