C20H22N4OS2 — CID 18199150
2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N,N-dimethyl-2-phenylacetamide (PubChem CID 18199150) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N,N-dimethyl-2-phenylacetamide.
| Compound Name | 2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N,N-dimethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 18199150 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N,N-dimethyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)C(Sc1nc(N)c2c3c(sc2n1)CCCC3)c1ccccc1 |
| InChI | InChI=1S/C20H22N4OS2/c1-24(2)19(25)16(12-8-4-3-5-9-12)27-20-22-17(21)15-13-10-6-7-11-14(13)26-18(15)23-20/h3-5,8-9,16H,6-7,10-11H2,1-2H3,(H2,21,22,23) |
| InChIKey | KNQZXVCICUKGQD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |