C19H26N4O3S3 — CID 25476414
(2S)-2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylpropanamide (PubChem CID 25476414) has the molecular formula C19H26N4O3S3 and a molecular weight of 454.64 g/mol. Its IUPAC name is (2S)-2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylpropanamide.
| Compound Name | (2S)-2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 25476414 |
| Molecular Formula | C19H26N4O3S3 |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2S)-2-[(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylpropanamide |
| SMILES | CCN(C(=O)[C@H](C)Sc1nc(N)c2c3c(sc2n1)CCCC3)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H26N4O3S3/c1-3-23(12-8-9-29(25,26)10-12)18(24)11(2)27-19-21-16(20)15-13-6-4-5-7-14(13)28-17(15)22-19/h11-12H,3-10H2,1-2H3,(H2,20,21,22)/t11-,12+/m0/s1 |
| InChIKey | BUTZCWNBMRJQJG-NWDGAFQWSA-N |
| XLogP | 2.67 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |