C22H29N3O6S2 — CID 26008450
[(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate (PubChem CID 26008450) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate.
| Compound Name | [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
|---|---|
| PubChem CID | 26008450 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [(2S)-1-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoate |
| SMILES | CCN(C(=O)[C@H](C)OC(=O)CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H29N3O6S2/c1-3-25(14-10-11-33(29,30)12-14)22(28)13(2)31-18(26)9-8-17-23-20(27)19-15-6-4-5-7-16(15)32-21(19)24-17/h13-14H,3-12H2,1-2H3,(H,23,24,27)/t13-,14+/m0/s1 |
| InChIKey | SVCFEJXSACHBNA-UONOGXRCSA-N |
| XLogP | 1.76 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |