C19H25N3O4S3 — CID 26933225
(2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 26933225) has the molecular formula C19H25N3O4S3 and a molecular weight of 455.63 g/mol. Its IUPAC name is (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 26933225 |
| Molecular Formula | C19H25N3O4S3 |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCN(C(=O)[C@@H](C)Sc1nc2sc3c(c2c(=O)[nH]1)CCCC3)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H25N3O4S3/c1-3-22(12-8-9-29(25,26)10-12)18(24)11(2)27-19-20-16(23)15-13-6-4-5-7-14(13)28-17(15)21-19/h11-12H,3-10H2,1-2H3,(H,20,21,23)/t11-,12+/m1/s1 |
| InChIKey | NTEOOEGWIGGKTI-NEPJUHHUSA-N |
| XLogP | 2.38 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |