C21H21BrN4O3S — CID 46666687
(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[(3-bromobenzoyl)amino]acetate (PubChem CID 46666687) has the molecular formula C21H21BrN4O3S and a molecular weight of 489.40 g/mol. Its IUPAC name is (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[(3-bromobenzoyl)amino]acetate.
| Compound Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[(3-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46666687 |
| Molecular Formula | C21H21BrN4O3S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[(3-bromobenzoyl)amino]acetate |
| SMILES | Nc1nc(COC(=O)CNC(=O)c2cccc(Br)c2)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C21H21BrN4O3S/c22-13-6-4-5-12(9-13)20(28)24-10-17(27)29-11-16-25-19(23)18-14-7-2-1-3-8-15(14)30-21(18)26-16/h4-6,9H,1-3,7-8,10-11H2,(H,24,28)(H2,23,25,26) |
| InChIKey | GGCKSELQLGHMCF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |