C23H22N4O4S — CID 24557489
(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 24557489) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 24557489 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCc1nc(N)c2c3c(sc2n1)CCCCC3)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22N4O4S/c1-12(27-21(28)13-7-5-6-8-14(13)22(27)29)23(30)31-11-17-25-19(24)18-15-9-3-2-4-10-16(15)32-20(18)26-17/h5-8,12H,2-4,9-11H2,1H3,(H2,24,25,26) |
| InChIKey | NGIYPCUJEUNTMN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|