C25H27N5O4S — CID 55458795
(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 55458795) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55458795 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)OCc2nc(N)c3c4c(sc3n2)CCCCC4)C1=O |
| InChI | InChI=1S/C25H27N5O4S/c1-2-25(15-9-5-3-6-10-15)23(32)30(24(33)29-25)13-19(31)34-14-18-27-21(26)20-16-11-7-4-8-12-17(16)35-22(20)28-18/h3,5-6,9-10H,2,4,7-8,11-14H2,1H3,(H,29,33)(H2,26,27,28) |
| InChIKey | UBKDTNZWJMJHBB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|