C16H14Cl2N2O5S — CID 4852083
(2,6-dichlorophenyl)methyl 3-[(2-amino-2-oxoethyl)sulfamoyl]benzoate (PubChem CID 4852083) has the molecular formula C16H14Cl2N2O5S and a molecular weight of 417.27 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 3-[(2-amino-2-oxoethyl)sulfamoyl]benzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 3-[(2-amino-2-oxoethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4852083 |
| Molecular Formula | C16H14Cl2N2O5S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 3-[(2-amino-2-oxoethyl)sulfamoyl]benzoate |
| SMILES | NC(=O)CNS(=O)(=O)c1cccc(C(=O)OCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O5S/c17-13-5-2-6-14(18)12(13)9-25-16(22)10-3-1-4-11(7-10)26(23,24)20-8-15(19)21/h1-7,20H,8-9H2,(H2,19,21) |
| InChIKey | GERMOZCVGSTWFN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |