C22H23NO5S — CID 55449951
(3-acetyl-2,4,6-trimethylphenyl)methyl 3-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 55449951) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is (3-acetyl-2,4,6-trimethylphenyl)methyl 3-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | (3-acetyl-2,4,6-trimethylphenyl)methyl 3-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55449951 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (3-acetyl-2,4,6-trimethylphenyl)methyl 3-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)OCc2c(C)cc(C)c(C(C)=O)c2C)c1 |
| InChI | InChI=1S/C22H23NO5S/c1-6-10-23-29(26,27)19-9-7-8-18(12-19)22(25)28-13-20-14(2)11-15(3)21(16(20)4)17(5)24/h1,7-9,11-12,23H,10,13H2,2-5H3 |
| InChIKey | DMIGLCHIPKOERW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|