C17H19N3O5S — CID 55555943
(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 55555943) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is (3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | (3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55555943 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)OCc2nc(C(C)(C)C)no2)c1 |
| InChI | InChI=1S/C17H19N3O5S/c1-5-9-18-26(22,23)13-8-6-7-12(10-13)15(21)24-11-14-19-16(20-25-14)17(2,3)4/h1,6-8,10,18H,9,11H2,2-4H3 |
| InChIKey | UUGOUYPEOCNMAM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|