C25H23N3O6S — CID 16595617
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(benzylsulfamoyl)benzoate (PubChem CID 16595617) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(benzylsulfamoyl)benzoate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16595617 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-(benzylsulfamoyl)benzoate |
| SMILES | CCOc1ccccc1-c1noc(COC(=O)c2cccc(S(=O)(=O)NCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C25H23N3O6S/c1-2-32-22-14-7-6-13-21(22)24-27-23(34-28-24)17-33-25(29)19-11-8-12-20(15-19)35(30,31)26-16-18-9-4-3-5-10-18/h3-15,26H,2,16-17H2,1H3 |
| InChIKey | SOASSFLWQLXNJW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |