C26H18N2O6 — CID 16595659
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 9,10-dioxoanthracene-1-carboxylate (PubChem CID 16595659) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 16595659 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CCOc1ccccc1-c1noc(COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C26H18N2O6/c1-2-32-20-13-6-5-10-17(20)25-27-21(34-28-25)14-33-26(31)19-12-7-11-18-22(19)24(30)16-9-4-3-8-15(16)23(18)29/h3-13H,2,14H2,1H3 |
| InChIKey | UMOAXHGMVGSVCN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|