C23H25N3O6S — CID 30136255
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 30136255) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 30136255 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CCOc1ccccc1-c1noc(COC(=O)c2ccccc2SCC(=O)NCCOC)n1 |
| InChI | InChI=1S/C23H25N3O6S/c1-3-30-18-10-6-4-8-16(18)22-25-21(32-26-22)14-31-23(28)17-9-5-7-11-19(17)33-15-20(27)24-12-13-29-2/h4-11H,3,12-15H2,1-2H3,(H,24,27) |
| InChIKey | ACVYSDLFDPCBNT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|