C22H23N3O5 — CID 55492956
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-benzamidobutanoate (PubChem CID 55492956) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-benzamidobutanoate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55492956 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-benzamidobutanoate |
| SMILES | CCOc1ccccc1-c1noc(COC(=O)CC(C)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-28-18-12-8-7-11-17(18)21-24-19(30-25-21)14-29-20(26)13-15(2)23-22(27)16-9-5-4-6-10-16/h4-12,15H,3,13-14H2,1-2H3,(H,23,27) |
| InChIKey | BFBJWTGQZFDTIT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |