C17H15N3O5S — CID 94008888
methyl 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoate (PubChem CID 94008888) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is methyl 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoate.
| Compound Name | methyl 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 94008888 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | methyl 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCc2nc(-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C17H15N3O5S/c1-24-17(21)13-8-5-9-14(10-13)26(22,23)18-11-15-19-16(20-25-15)12-6-3-2-4-7-12/h2-10,18H,11H2,1H3 |
| InChIKey | JERXLLZACYQLLQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |