C17H17N3O3S — CID 110322575
4-ethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide (PubChem CID 110322575) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-ethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110322575 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-ethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCc2nc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C17H17N3O3S/c1-2-13-8-10-15(11-9-13)24(21,22)18-12-16-19-17(20-23-16)14-6-4-3-5-7-14/h3-11,18H,2,12H2,1H3 |
| InChIKey | AEKKYSKPZGGINE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |