C19H19NO4S — CID 55490346
(2,5-dimethylphenyl)methyl 4-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 55490346) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 4-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 4-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55490346 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 4-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)OCc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H19NO4S/c1-4-11-20-25(22,23)18-9-7-16(8-10-18)19(21)24-13-17-12-14(2)5-6-15(17)3/h1,5-10,12,20H,11,13H2,2-3H3 |
| InChIKey | CPMQGXILZPGHAV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|